Identification |
Name: | 1H-Indole-2,3-dione,1-(2-propen-1-yl)- |
Synonyms: | 1H-Indole-2,3-dione,1-(2-propenyl)- (9CI); Indole-2,3-dione, 1-allyl- (7CI,8CI);1-Allyl-1H-indole-2,3-dione; 1-Allylisatin; N-Allylisatin |
CAS: | 830-74-0 |
Molecular Formula: | C11H9 N O2 |
Molecular Weight: | 187.2 |
InChI: | InChI=1/C11H9NO2/c1-2-7-12-9-6-4-3-5-8(9)10(13)11(12)14/h2-6H,1,7H2 |
Molecular Structure: |
 |
Properties |
Melting Point: | 87-90°C |
Flash Point: | 146.4°C |
Boiling Point: | 321.7°C at 760 mmHg |
Density: | 1.233g/cm3 |
Refractive index: | 1.591 |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | 146.4°C |
Safety Data |
|
 |