| Identification | |
| Name: | 4-Isoxazolepropanoicacid, a-amino-2,3-dihydro-5-methyl-3-oxo-,(aS)- |
| Synonyms: | 4-Isoxazolepropanoicacid, a-amino-2,3-dihydro-5-methyl-3-oxo-,(S)-; L-AMPA; S-AMPA |
| CAS: | 83643-88-3 |
| Molecular Formula: | C7H10 N2 O4 |
| Molecular Weight: | 186.1653 |
| InChI: | InChI=1S/C7H10N2O4/c1-3-4(6(10)9-13-3)2-5(8)7(11)12/h5H,2,8H2,1H3,(H,9,10)(H,11,12)/t5-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 230ºC |
| Density: | 1.386 g/cm3 |
| Water Solubility: | Soluble in water or dilute aqueous base. |
| Solubility: | Soluble in water or dilute aqueous base. |
| Appearance: | White to off-white powder. |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Biological Activity: | Active enantiomer of AMPA (EC 50 = 3.5 μ M). Also available as part of the AMPA Receptor Tocriset™ . |
| Storage Temperature: | Store at RT |
| Safety Data | |
 |
|
