| Identification | |
| Name: | Acetic acid,2-(2-chloroethoxy)-, methyl ester |
| Synonyms: | Aceticacid, (2-chloroethoxy)-, methyl ester (7CI,9CI);Methyl (2-chloroethoxy)acetate;Methyl 2-(2-chloroethoxy)acetate; |
| CAS: | 83881-47-4 |
| Molecular Formula: | C5H9ClO3 |
| Molecular Weight: | 152.58 |
| InChI: | InChI=1/C5H9ClO3/c1-8-5(7)4-9-3-2-6/h2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.153 g/cm3 |
| Refractive index: | 1.421 |
| Specification: |
The Methyl 2-(2-chloroethoxy)acetate with the CAS number 83881-47-4 is also called Acetic acid,2-(2-chloroethoxy)-, methyl ester. The systematic name is methyl (2-chloroethoxy)acetate. Its molecular formula is C5H9ClO3. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 0.48; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1; (4)ACD/LogD (pH 7.4): 1; (5)ACD/BCF (pH 5.5): 2; (6)ACD/BCF (pH 7.4): 2; (7)ACD/KOC (pH 5.5): 54; (8)ACD/KOC (pH 7.4): 54; (9)#H bond acceptors: 3; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 5; (12)Polar Surface Area: 35.53 Å2; (13)Index of Refraction: 1.421; (14)Molar Refractivity: 33.582 cm3; (15)Molar Volume: 132.298 cm3; (16)Polarizability: 13.313×10-24cm3; (17)Surface Tension: 31.699 dyne/cm; (18)Enthalpy of Vaporization: 44.605 kJ/mol ; (19)Vapour Pressure: 0.199 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
