| Identification | |
| Name: | PHA 767491 HYDROCHLORIDE |
| Synonyms: | PHA 767491 HYDROCHLORIDE |
| CAS: | 845714-00-3 |
| Molecular Formula: | C12H11N3O.ClH |
| Molecular Weight: | 249.7 |
| InChI: | InChI=1/C12H11N3O.ClH/c16-12-9-7-11(8-1-4-13-5-2-8)15-10(9)3-6-14-12;/h1-2,4-5,7,15H,3,6H2,(H,14,16);1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 329.1°C |
| Boiling Point: | 620.6°C at 760 mmHg |
| Density: | 1.287 |
| Biological Activity: | Potent, ATP-competitive dual cdc7/cdk9 inhibitor (IC 50 values are 10 and 34 nM respectively) that prevents initiation of DNA replication. Inhibits cell proliferation in a variety of human cell lines (IC 50 ~ 0.86 - 5.87 μ M) and induces apoptosis in a p53-independent manner in vivo . Also inhibits mitogen-activated protein kinase-activated protein kinase-2 (MK-2) (IC 50 = 171 nM). |
| Flash Point: | 329.1°C |
| Storage Temperature: | Desiccate at RT |
| Safety Data | |
 |
|
