| Identification | |
| Name: | Boronic acid,B-[2-methyl-4-(phenylmethoxy)phenyl]- |
| Synonyms: | Boronicacid, [2-methyl-4-(phenylmethoxy)phenyl]- (9CI);4-Benzyloxy-2-methylphenylboronic acid |
| CAS: | 847560-49-0 |
| Molecular Formula: | C14H15 B O3 |
| Molecular Weight: | 242.08 |
| InChI: | InChI=1/C14H15BO3/c1-11-9-13(7-8-14(11)15(16)17)18-10-12-5-3-2-4-6-12/h2-9,16-17H,10H2,1H3 |
| Molecular Structure: | ![(C14H15BO3) Boronicacid, [2-methyl-4-(phenylmethoxy)phenyl]- (9CI);4-Benzyloxy-2-methylphenylboronic acid](https://img.guidechem.com/casimg/847560-49-0.gif) |
| Properties | |
| Melting Point: | 154-158 |
| Flash Point: | 217.6°C |
| Boiling Point: | 436.2°C at 760 mmHg |
| Density: | 1.17g/cm3 |
| Refractive index: | 1.585 |
| Specification: | usageEng:suzuki reaction Safety Statements:26-36/37/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| HS Code: | 29310095 |
| Flash Point: | 217.6°C |
| Usage: | suzuki reaction |
| Safety Data | |
 |
|
