| Identification | |
| Name: | 2,6-difluorobenzyl bromide |
| Synonyms: | 1-Bromomethyl-2,6-difluorobenzene;2,6-Difluoro-a-bromotoluene;2-(Bromomethyl)-1,3-difluorobenzene;a-Bromo-2,6-difluorotoluene; |
| CAS: | 85118-00-9 |
| EINECS: | 285-652-6 |
| Molecular Formula: | C7H5BrF2 |
| Molecular Weight: | 207.015406 |
| InChI: | InChI=1S/C7H5BrF2/c8-4-5-6(9)2-1-3-7(5)10/h1-3H,4H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 8 |
| Flash Point: | 65.6 ºC |
| Boiling Point: | 184.9ºC at 760 mmHg |
| Density: | 1.625 g/cm3 |
| Refractive index: | 1.522 |
| Water Solubility: | Insoluble in water |
| Solubility: | Insoluble in water |
| Appearance: | White to off-white solid./colorless crystal |
| Specification: | white to light yellow crystal powder Safety Statements:26-36/37/39-45-25-27 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 25:Avoid contact with eyes 27:Take off immediately all contaminated clothing |
| Packinggroup: | III |
| Flash Point: | 65.6 ºC |
| Sensitive: | Lachrymatory |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
