| Identification |
| Name: | 3,4-Difluorobenzyl bromide |
| Synonyms: | 2H-Perfluoro-5,8-dimethyl-3,6,9-trioxadodecane;4-(Bromomethyl)-1,2-difluorobenzene;alpha-Bromo-3,4-difluorotoluene;Benzene, 4-(bromomethyl)-1,2-difluoro-; |
| CAS: | 85118-01-0 |
| EINECS: | 285-653-1 |
| Molecular Formula: | C7H5BrF2 |
| Molecular Weight: | 207.01 |
| InChI: | InChI=1/C7H5BrF2/c8-4-5-1-2-6(9)7(10)3-5/h1-3H,4H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 |
| Boiling Point: | 59-61°C 3,5mm |
| Density: | 1.618 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.525-1.527 |
| Solubility: | Insoluble |
| Appearance: | Colorless liquid. |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Sensitive: | Lachrymatory |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
