| Identification | |
| Name: | (R)-(-)-Rolipram |
| Synonyms: | (R)-4-(3-(Cyclopentyloxy)-4-methoxyphenyl)pyrrolidin-2-one |
| CAS: | 85416-75-7 |
| Molecular Formula: | C16H21NO3 |
| Molecular Weight: | 275.34 |
| InChI: | InChI=1S/C16H21NO3/c1-19-14-7-6-11(12-9-16(18)17-10-12)8-15(14)20-13-4-2-3-5-13/h6-8,12-13H,2-5,9-10H2,1H3,(H,17,18) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.155 g/cm3 |
| Biological Activity: | More active enantiomer of the PDE4 inhibitor rolipram (4-(3-(Cyclopentyloxy)-4-methoxyphenyl)pyrrolidin-2-one ); 2-10-fold more potent than the S-(+) enantiomer ((4S)-4-[3-(Cyclopentyloxy)-4-methoxyphenyl]pyrrolidin-2-one ). Also available as part of the Phosphodiesterase Inhibitor Tocriset™ . |
| Storage Temperature: | Store at RT |
| Safety Data | |
 |
|
