| Identification | |
| Name: | (-)-QUINPIROLE HYDROCHLORIDE |
| Synonyms: | (4AR-TRANS)-4,4A,5,6,7,8,8A,9-OCTAHYDRO-5-PROPYL-1H-PYRAZOLO[3,4-G]QUINOLINE HYDROCHLORIDE;LY-171,555;(-)-QUINPIROLE HCL;(-)-QUINPIROLE HYDROCHLORIDE;TRANS-(-)-4AR-4,4A,5,6,7,8,8A,9-OCTAHYDRO-5-PROPYL-1H-PYRAZOLO[3,4-G] QUINOLINE HYDROCHLORIDE;Quinpirole;1H-Pyrazolo(3,4-G)quinoline, 4,4A,5,6,7,8,8A,9-octahydro-5-propyl-, (4ar-trans)-;D019257 |
| CAS: | 85760-74-3 |
| Molecular Formula: | C13H22ClN3 |
| Molecular Weight: | 255.79 |
| InChI: | InChI=1/C13H21N3.ClH/c1-2-5-16-6-3-4-10-7-12-11(8-13(10)16)9-14-15-12;/h9-10,13H,2-8H2,1H3,(H,14,15);1H/t10-,13-;/m1./s1 |
| Molecular Structure: | ![(C13H22ClN3) (4AR-TRANS)-4,4A,5,6,7,8,8A,9-OCTAHYDRO-5-PROPYL-1H-PYRAZOLO[3,4-G]QUINOLINE HYDROCHLORIDE;LY-171,55...](https://img.guidechem.com/structure/85760-74-3.gif) |
| Properties | |
| Flash Point: | 186°C |
| Boiling Point: | 383.9°C at 760 mmHg |
| Biological Activity: | Selective dopamine D 2 receptor agonist (K i values are 4.8, ~24, ~30 and 1900 nM at D 2 , D 3 , D 4 and D 1 receptors respectively). |
| Flash Point: | 186°C |
| Safety Data | |
 |
|
