| Identification | |
| Name: | 1-Naphthoic acid |
| Synonyms: | 1-Carboxynaphthalene;alpha-Naphthoic acid;naphthalene-1-carboxylate;alpha-Naphthylcarboxylic acid;1-Naphthoicacid;naphthalene-1-carboxylic acid;Naphthalene-alpha-carboxylic acid;1-naphthalenecarboxylic acid;.alpha.-Naphthoic acid; |
| CAS: | 86-55-5 |
| EINECS: | 201-681-9 |
| Molecular Formula: | C11H8O2 |
| Molecular Weight: | 172.18 |
| InChI: | InChI=1/C11H8O2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 164.6 ºC |
| Density: | 1.398 |
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. |
| Refractive index: | 1.46 (20 C) |
| Solubility: | Very soluble |
| Appearance: | white to off white crystals |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | Z01 |
| HS Code: | 29163900 |
| Flash Point: | 164.6 ºC |
| Storage Temperature: | Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
