| Identification | |
| Name: | Piperazine,1-(3-nitro-2-pyridinyl)- |
| Synonyms: | 2-(1-Piperazinyl)-3-nitropyridine;2-Piperazino-3-nitropyridine; |
| CAS: | 87394-48-7 |
| Molecular Formula: | C9H12N4O2 |
| Molecular Weight: | 208.22 |
| InChI: | InChI=1/C9H12N4O2/c14-13(15)8-2-1-3-11-9(8)12-6-4-10-5-7-12/h1-3,10H,4-7H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.278 g/cm3 |
| Refractive index: | 1.583 |
| Specification: |
The 1-(3-Nitorpyridin-2-yl)piperazine with its cas register number is 87394-48-7. It also can be called as Piperazine,1-(3-nitro-2-pyridinyl)- and the IUPAC Name about this chemical is 1-(3-nitropyridin-2-yl)piperazine. It belongs to the following product categories, such as pharmacetical, Pyridines and so on. Physical properties about 1-(3-Nitorpyridin-2-yl)piperazine are: (1)ACD/LogP: 1.23; (2)#H bond acceptors: 6; (3)#H bond donors: 1; (4)#Freely Rotating Bonds: 2; (5)Polar Surface Area: 65.19Å2; (6)Index of Refraction: 1.583; (7)Molar Refractivity: 54.44 cm3; (8)Molar Volume: 162.7 cm3; (9)Polarizability: 21.58x10-24cm3; (10)Surface Tension: 54.1 dyne/cm; (11)Enthalpy of Vaporization: 63.7 kJ/mol; (12)Vapour Pressure: 3.2E-06 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
