| Identification | |
| Name: | Benzene,2-chloro-1,3,5-trinitro- |
| Synonyms: | 1-Chloro-2,4,6-trinitrobenzene;2,4,6-Trinitro-1-chlorobenzene; 2,4,6-Trinitrochlorobenzene;2-Chloro-1,3,5-trinitrobenzene; NSC 106297; NSC 1872; Picryl chloride |
| CAS: | 88-88-0 |
| EINECS: | 201-864-3 |
| Molecular Formula: | C6H2 Cl N3 O6 |
| Molecular Weight: | 247.56 |
| InChI: | InChI=1/C6H2ClN3O6/c7-6-4(9(13)14)1-3(8(11)12)2-5(6)10(15)16/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3365 4.1/PG 1 |
| Melting Point: | 83 - 85 C |
| Boiling Point: | 354.1°C at 760 mmHg |
| Density: | 1.80 |
| Stability: | Very unstable when dry. Incompatible with oxidizing agents, chlorates, nitrates. Flammable solid. |
| Refractive index: | 1.664 |
| Water Solubility: | negligible Stability Very unstable when dry. Incompatiblewith oxidizing agents, chlorates, nitrates. Flammable solid. Toxicology Likely to be a skin, eye and respiratory irritant. |
| Solubility: | negligible
|
| Appearance: | white to cream crystalline powder |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Color: | Almost white needles White needles or plates from chloroform, alcohol, & ligand |
| Safety Data | |
| Hazard Symbols | |
 |
|
