| Identification | |
| Name: | phthalamic acid |
| Synonyms: | Phthalamic acid, (2-Carboxybenzamide); 2-Carboxybenzamide |
| CAS: | 88-97-1 |
| EINECS: | 201-871-1 |
| Molecular Formula: | C8H7NO3 |
| Molecular Weight: | 165.14 |
| InChI: | InChI=1/C8H7NO3/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H2,9,10)(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 140-143 °C(lit.) |
| Flash Point: | 192.2°C |
| Boiling Point: | 394.2°C at 760 mmHg |
| Density: | 1.368g/cm3 |
| Refractive index: | 1.615 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 192.2°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
