| Identification |
| Name: | 4-Nitro-m-xylene |
| Synonyms: | 1,3-Dimethyl-4-nitrobenzene; 2,4-Dimethylnitrobenzene; 4-Nitro-1,3-Dimethylbenzene; Nitromxylene; 2,4-Dimethy Nitrobenzene |
| CAS: | 89-87-2 |
| EINECS: | 201-947-4 |
| Molecular Formula: | C8H9NO2 |
| Molecular Weight: | 151.16 |
| InChI: | InChI=1/C8H9NO2/c1-6-3-4-8(9(10)11)7(2)5-6/h3-5H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1665 |
| Density: | 1.117 |
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. |
| Refractive index: | 1.5485-1.5505 |
| Solubility: | Insoluble |
| Appearance: | clear
to pale yellow liquid |
| Packinggroup: | II |
| HS Code: | 29042000 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
