| Identification | |
| Name: | Acetic acid,2,2-dimethoxy-, methyl ester |
| Synonyms: | Aceticacid, dimethoxy-, methyl ester (9CI); Glyoxylic acid, methyl ester, 2-(dimethylacetal) (8CI); Glyoxylic acid, methyl ester, dimethyl acetal (6CI,7CI);2,2-Dimethoxyacetic acid methyl ester; Dimethoxyacetic acid methyl ester;Methyl 2,2-dimethoxyacetate; Methyl dimethoxyacetate; Methyl glyoxylatedimethyl acetal; NSC 27791 |
| CAS: | 89-91-8 |
| EINECS: | 201-950-0 |
| Molecular Formula: | C5H10 O4 |
| Molecular Weight: | 134.13 |
| InChI: | InChI=1/C5H10O4/c1-7-4(6)5(8-2)9-3/h5H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.096 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.404-1.406 |
| Appearance: | Clear, colorless liquid. |
| Specification: |
Methyl dimethoxyacetate , its CAS NO. is 89-91-8, the synonyms are AI3-52473 ; Dimethoxyacetic acid methyl ester ; EINECS 201-950-0 ; Glyoxylic acid methyl ester dimethyl acetal ; Methyl 2,2-dimethoxyacetate ; NSC 27791 ; Acetic acid, 2,2-dimethoxy-, methyl ester ; Acetic acid, dimethoxy-, methyl ester . |
| Storage Temperature: | 0-6°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
 |
|
