Identification |
Name: | Phenol,4-(trans-4-ethylcyclohexyl)- |
Synonyms: | Phenol,4-(4-ethylcyclohexyl)-, trans-; 4-(trans-4-Ethylcyclohexyl)phenol |
CAS: | 89100-78-7 |
Molecular Formula: | C14H20 O |
Molecular Weight: | 204.31 |
InChI: | InChI=1/C14H20O/c1-2-11-3-5-12(6-4-11)13-7-9-14(15)10-8-13/h7-12,15H,2-6H2,1H3/t11-,12- |
Molecular Structure: |
 |
Properties |
Melting Point: | 127-129 ºC |
Density: | 0.988 |
Refractive index: | 1.524 |
Specification: |
4-trans(4-Ethyl cyclohexyl)phenol ,its cas register number is 89100-78-7. It also can be called Phenol, 4-(trans-4-ethylcyclohexyl)- . And its systematic name is 4-(4-Ethylcyclohexyl)phenol .
|
Safety Data |
|
 |