| Identification | |
| Name: | Phenol,4-(trans-4-ethylcyclohexyl)- |
| Synonyms: | Phenol,4-(4-ethylcyclohexyl)-, trans-; 4-(trans-4-Ethylcyclohexyl)phenol |
| CAS: | 89100-78-7 |
| Molecular Formula: | C14H20 O |
| Molecular Weight: | 204.31 |
| InChI: | InChI=1/C14H20O/c1-2-11-3-5-12(6-4-11)13-7-9-14(15)10-8-13/h7-12,15H,2-6H2,1H3/t11-,12- |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 127-129 ºC |
| Density: | 0.988 |
| Refractive index: | 1.524 |
| Specification: |
4-trans(4-Ethyl cyclohexyl)phenol ,its cas register number is 89100-78-7. It also can be called Phenol, 4-(trans-4-ethylcyclohexyl)- . And its systematic name is 4-(4-Ethylcyclohexyl)phenol . |
| Safety Data | |
 |
|
