Identification |
Name: | Polyoxyethylene dioleate |
Synonyms: | Poly(oxy-1,2-ethanediyl),R-[(9Z)-1-oxo-9- octadecenyl]-?-[[(9Z)-1-oxo-9-octadecenyl]- oxy]-;Alkasurf 600DO;Ionet DO;Alkamuls 600DO;Cithrol 4DO;Mapeg 400DO;Alkasurf 400DO;Mapeg 200DO;Marlosol FS;Emalex 300di-O;Mapeg 600DO;Emalex 600di-O;Marlipal FS;PEG-8 dioleate;PEG 600 dioleate;PEG 400 dioleate;Polyethylene glycol 400 dioleate acid ester.; |
CAS: | 9005-07-6 |
EINECS: | 213-170-8 |
Molecular Formula: | (C2H4O)multC36H66O3 |
Molecular Weight: | 0 |
InChI: | InChI=1/C38H70O4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37(39)41-35-36-42-38(40)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20H,3-16,21-36H2,1-2H3/b19-17-,20-18- |
Molecular Structure: |
|
Properties |
Melting Point: | −15 °C(lit.) |
Flash Point: | 299.3°C |
Boiling Point: | >260 °C(lit.) |
Density: | 0.909g/cm3 |
Refractive index: | n20/D 1.471(lit.) |
Flash Point: | 299.3°C |
Usage: | Pegosperse(R) 600 DO is a surfactant suggested for use in paper defoamer formulations (emulsifier mineral oil or non mineral oil based), coatings (solvent and solventless systems emulsifier) and textile (spin finish lubricant) |
Safety Data |
|
|