Identification |
Name: | N,N-Diethylaniline |
Synonyms: | DEA; N,N-Diethyl aniline |
CAS: | 91-66-7 |
EINECS: | 202-088-8 |
Molecular Formula: | C10H15N |
Molecular Weight: | 149.23 |
InChI: | InChI=1/C10H15N/c1-3-11(4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Transport: | UN 2432 |
Density: | 0.938 |
Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong acids. |
Refractive index: | 1.541-1.543 |
Solubility: | 1.4 g/100ml |
Appearance: | Pale Yellow to Brown Liquid |
Packinggroup: | III |
Color: | Colorless to yellow liquid BROWN OILY LIQUID |
Safety Data |
Hazard Symbols |
T:Toxic
N:Dangerousfortheenvironment
|
|
 |