| Identification | |
| Name: | Naphthol AS |
| Synonyms: | 2-Naphthalenecarboxamide, 3-hydroxy-N-phenyl-; 3-Hydroxy-2-naphthoic aicd anilide; Azoic CC2; C.I. 37505; C.I. 37560; C.I. Azoic Coupling Component No. 4; Naphthol AS-BO; 2-Hydroxy-3-Naphthanilide; |
| CAS: | 92-77-3 |
| EINECS: | 202-188-1 |
| Molecular Formula: | C17H13NO2 |
| Molecular Weight: | 263.29062 |
| InChI: | InChI=1S/C17H13NO2/c19-16-11-13-7-5-4-6-12(13)10-15(16)17(20)18-14-8-2-1-3-9-14/h1-11,19H,(H,18,20) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 |
| Boiling Point: | 494 |
| Density: | 1.31 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | AUTOIGNITION |
| Solubility: | AUTOIGNITION |
| Appearance: | Light creamy beigr powder |
| Specification: | beige powder Safety Statements:36/37-61 36/37:Wear suitable protective clothing and gloves 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Intermediate for manufacturingt azo organic pigments and some dyestuffs. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
