| Identification | |
| Name: | Phenol,2-methoxy-4-(2-propen-1-yl)-, 1-acetate |
| Synonyms: | Eugenolacetate (6CI);Phenol, 2-methoxy-4-(2-propenyl)-, acetate (9CI);Phenol,4-allyl-2-methoxy-, acetate (7CI,8CI);4-Allyl-2-methoxyphenyl acetate;Aceteugenol;Acetyleugenol;NSC 1242;O-Acetyleugenol; |
| CAS: | 93-28-7 |
| EINECS: | 202-235-6 |
| Molecular Formula: | C12H14O3 |
| Molecular Weight: | 206.24 |
| InChI: | InChI=1/C12H14O3/c1-4-5-10-6-7-11(15-9(2)13)12(8-10)14-3/h4,6-8H,1,5H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 200kgs |
| Melting Point: | 29 - 31 C |
| Flash Point: | 110 ºC |
| Boiling Point: | 281 - 286 C |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.518 |
| Water Solubility: | Insoluble (Soluble in alcohol) |
| Solubility: | Insoluble (Soluble in alcohol) |
| Appearance: | Clear to pale yellow oily liquid |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 110 ºC |
| Safety Data | |
 |
|
