| Identification | |
| Name: | Phenol,2-methoxy-4-(1-propen-1-yl)-, 1-acetate |
| Synonyms: | Isoeugenol,acetate (6CI);Phenol, 2-methoxy-4-(1-propenyl)-, acetate (9CI);Phenol,2-methoxy-4-propenyl-, acetate (7CI,8CI);2-Methoxy-4-propenylphenyl acetate;4-Acetoxy-3-methoxy-1-propenylbenzene;Acetylisoeugenol;NSC 46121;O-Acetylisoeugenol; |
| CAS: | 93-29-8 |
| EINECS: | 202-236-1 |
| Molecular Formula: | C12H14O3 |
| Molecular Weight: | 206.24 |
| InChI: | InChI=1/C12H14O3/c1-4-5-10-6-7-11(15-9(2)13)12(8-10)14-3/h4-8H,1-3H3/b5-4+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.073 g/cm3 |
| Refractive index: | 1.539 |
| Specification: |
Isoeugenyl acetate (93-29-8) also can be called Isoeugenol acetate ; Phenol, 2-methoxy-4-[(1E)-1-propen-1-yl]-, acetate ; 2-Methoxy-4-[(1E)-prop-1-en-1-yl]phenyl acetate ; 2-Methoxy-4-[(1E)-1-propenyl]phenyl acetate and Phenol, 2-methoxy-4-(1-propenyl)-, acetate, (E)- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
