Identification |
Name: | 5H-Thiazolo[3,2-a]pyrimidin-5-one,6-[2-[4-[(4-fluorophenyl)phenylmethylene]-1-piperidinyl]ethyl]-7-methyl- |
Synonyms: | DKGI-I;Diacylglycerol kinase inhibitor I; R 59-022 |
CAS: | 93076-89-2 |
Molecular Formula: | C27H26 F N3 O S |
Molecular Weight: | 459.58 |
InChI: | InChI=1/C27H26FN3OS/c1-19-24(26(32)31-17-18-33-27(31)29-19)13-16-30-14-11-22(12-15-30)25(20-5-3-2-4-6-20)21-7-9-23(28)10-8-21/h2-10,17-18H,11-16H2,1H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 328.6°C |
Boiling Point: | 619.8°Cat760mmHg |
Density: | 1.26g/cm3 |
Refractive index: | 1.654 |
Biological Activity: | Diacylglycerol (DAG) kinase inhibitor (IC 50 = 2.8 μ M); increases protein kinase C activity. Potentiates thrombin-induced platelet aggregation and induces neutrophil chemotaxis. Inhibits U46619-induced contractions in mouse aorta and porcine coronary artery. |
Flash Point: | 328.6°C |
Storage Temperature: | −70°C |
Color: | pale yellow |
Safety Data |
|
|