| Identification | |
| Name: | M-chloroperoxybenzoic acid |
| Synonyms: | 3-Chloroperbenzoic acid; m-Chloroperbenzoic acid; m-CPBA ; 3-Chloroperoxybenzoic acid; MCPBA |
| CAS: | 937-14-4 |
| EINECS: | 213-322-3 |
| Molecular Formula: | C7H5ClO3 |
| Molecular Weight: | 172.57 |
| InChI: | InChI=1/C7H5ClO3/c8-6-3-1-2-5(4-6)7(9)11-10/h1-4,10H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2755/3106 |
| Density: | 0.56 |
| Stability: | Strong oxidizing agent - contact with combustible material may cause fire. May be shock or heat sensitive. Incompatible with organic materials, strong reducing agents. |
| Refractive index: | 1.571 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | white powder |
| Specification: |
? 3-Chloroperoxybenzoic acid , with CAS number of 937-14-4, can be called 3-Chloroperbenzoic acid ; 3-Chlorobenzenecarboperoxoic acid ; m-Chlorobenzoyl hydroperoxide ; m-Chloroperbenzoic acid ; m-Chloroperoxobenzoicacid ; m-Chloroperoxybenzoic acid . 3-Chloroperoxybenzoic acid (CAS NO.937-14-4) is the white crystalline powder. Almost insoluble in water, soluble in alcohol, ether, dissolved in chloroform, dichloroethane. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Usage: | Used widely as an oxidant in organic synthesis. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
