| Identification | |
| Name: | 1(2H)-Naphthalenone,5-fluoro-3,4-dihydro- |
| Synonyms: | 5-Fluoro-3,4-dihydro-2H-naphthalen-1-one;5-Fluoro-3,4-dihydronaphthalen-1(2H)-one; |
| CAS: | 93742-85-9 |
| Molecular Formula: | C10H9FO |
| Molecular Weight: | 164.18 |
| InChI: | InChI=1/C10H9FO/c11-9-5-1-4-8-7(9)3-2-6-10(8)12/h1,4-5H,2-3,6H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.198 g/cm3 |
| Refractive index: | 1.542 |
| Specification: |
The 5-Fluoro-1-tetralone, with the CAS registry number 93742-85-9, is also known as 1(2H)-Naphthalenone, 5-fluoro-3,4-dihydro-. It belongs to the product category of Halide. This chemical's molecular formula is C10H9FO and molecular weight is 164.18. Its systematic name is called 5-fluoro-3,4-dihydronaphthalen-1(2H)-one. Physical properties of 5-Fluoro-1-tetralone: (1)ACD/LogP: 2.71; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.71; (4)ACD/LogD (pH 7.4): 2.71; (5)ACD/BCF (pH 5.5): 68.04; (6)ACD/BCF (pH 7.4): 68.04; (7)ACD/KOC (pH 5.5): 713.7; (8)ACD/KOC (pH 7.4): 713.7; (9)#H bond acceptors: 1; (10)Index of Refraction: 1.542; (11)Molar Refractivity: 43.16 cm3; (12)Molar Volume: 136.9 cm3; (13)Surface Tension: 40.3 dyne/cm; (14)Density: 1.198 g/cm3; (15)Flash Point: 101.4 °C; (16)Enthalpy of Vaporization: 50.36 kJ/mol; (17)Boiling Point: 265.6 °C at 760 mmHg; (18)Vapour Pressure: 0.00906 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
