Identification |
Name: | undecenoic acid, compound with 2,2'-iminodiethanol (1:1) |
Synonyms: | Undecenoic acid, compound with 2,2'-iminodiethanol (1:1);2-(2-hydroxyethylamino)ethanol; undec-2-enoic acid |
CAS: | 93882-26-9 |
EINECS: | 299-423-3 |
Molecular Formula: | C15H31NO4 |
Molecular Weight: | 289.4109 |
InChI: | InChI=1/C11H20O2.C4H11NO2/c1-2-3-4-5-6-7-8-9-10-11(12)13;6-3-1-5-2-4-7/h9-10H,2-8H2,1H3,(H,12,13);5-7H,1-4H2 |
Molecular Structure: |
![(C15H31NO4) Undecenoic acid, compound with 2,2'-iminodiethanol (1:1);2-(2-hydroxyethylamino)ethanol; undec-2-eno...](https://img.guidechem.com/pic/image/93882-26-9.gif) |
Properties |
Flash Point: | 247.5°C |
Boiling Point: | 485.7°C at 760 mmHg |
Flash Point: | 247.5°C |
Safety Data |
|
![](/images/detail_15.png) |