| Identification |
| Name: | undecanoic acid, compound with piperazine-1,4-diethanol (1:1) |
| Synonyms: | Undecanoic acid, compound with piperazine-1,4-diethanol (1:1);2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol; undecanoic acid |
| CAS: | 93966-46-2 |
| EINECS: | 300-998-0 |
| Molecular Formula: | C19H40N2O4 |
| Molecular Weight: | 360.5319 |
| InChI: | InChI=1/C11H22O2.C8H18N2O2/c1-2-3-4-5-6-7-8-9-10-11(12)13;11-7-5-9-1-2-10(4-3-9)6-8-12/h2-10H2,1H3,(H,12,13);11-12H,1-8H2 |
| Molecular Structure: |
![(C19H40N2O4) Undecanoic acid, compound with piperazine-1,4-diethanol (1:1);2-[4-(2-hydroxyethyl)piperazin-1-yl]et...](https://img.guidechem.com/pic/image/93966-46-2.gif) |
| Properties |
| Flash Point: | 277.2°C |
| Boiling Point: | 534.8°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 277.2°C |
| Safety Data |
| |
 |
