Identification |
Name: | undecanoic acid, compound with piperazine-1,4-diethanol (1:1) |
Synonyms: | Undecanoic acid, compound with piperazine-1,4-diethanol (1:1);2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol; undecanoic acid |
CAS: | 93966-46-2 |
EINECS: | 300-998-0 |
Molecular Formula: | C19H40N2O4 |
Molecular Weight: | 360.5319 |
InChI: | InChI=1/C11H22O2.C8H18N2O2/c1-2-3-4-5-6-7-8-9-10-11(12)13;11-7-5-9-1-2-10(4-3-9)6-8-12/h2-10H2,1H3,(H,12,13);11-12H,1-8H2 |
Molecular Structure: |
![(C19H40N2O4) Undecanoic acid, compound with piperazine-1,4-diethanol (1:1);2-[4-(2-hydroxyethyl)piperazin-1-yl]et...](https://img.guidechem.com/pic/image/93966-46-2.gif) |
Properties |
Flash Point: | 277.2°C |
Boiling Point: | 534.8°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 277.2°C |
Safety Data |
|
 |