Identification |
Name: | cinnamic acid, compound with piperazine-1,4-diethanol (1:1) |
Synonyms: | Cinnamic acid, compound with piperazine-1,4-diethanol (1:1);2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol; (E)-3-phenylprop-2-enoic acid |
CAS: | 93942-30-4 |
EINECS: | 300-581-3 |
Molecular Formula: | C17H26N2O4 |
Molecular Weight: | 322.3993 |
InChI: | InChI=1/C9H8O2.C8H18N2O2/c10-9(11)7-6-8-4-2-1-3-5-8;11-7-5-9-1-2-10(4-3-9)6-8-12/h1-7H,(H,10,11);11-12H,1-8H2/b7-6+; |
Molecular Structure: |
![(C17H26N2O4) Cinnamic acid, compound with piperazine-1,4-diethanol (1:1);2-[4-(2-hydroxyethyl)piperazin-1-yl]etha...](https://img.guidechem.com/pic/image/93942-30-4.gif) |
Properties |
Flash Point: | 284.3°C |
Boiling Point: | 546.5°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 284.3°C |
Safety Data |
|
 |