Identification |
Name: | Hexanoic acid,2-ethyl-, ethenyl ester |
Synonyms: | Hexanoicacid, 2-ethyl-, vinyl ester (6CI,7CI,8CI); 2-Ethylhexanoic acid, vinyl ester;NSC 5312; Vinyl 2-ethylhexanoate; Vinyl 2-ethylhexoate; Vynate 2EH |
CAS: | 94-04-2 |
EINECS: | 202-297-4 |
Molecular Formula: | C10H18 O2 |
Molecular Weight: | 170.28 |
InChI: | InChI=1/C10H18O2/c1-4-7-8-9(5-2)10(11)12-6-3/h6,9H,3-5,7-8H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Transport: | 3082 |
Melting Point: | −90 °C(lit.) |
Flash Point: | 65 C |
Boiling Point: | 86°C 30mm |
Density: | 0,87 g/cm3 |
Stability: | Stable. Incompatible with strong oxidizing agents, strong acids, strong bases. |
Refractive index: | n20/D 1.426(lit.) |
Solubility: | |
Appearance: | colourless liquid |
Specification: |
2-Ethylhexanoic Acid Vinyl Ester (94-04-2) is a colourless liquid. It is stable and incompatible with strong oxidizing agents, strong acids, strong bases.
|
Packinggroup: | III |
Flash Point: | 65 C |
Safety Data |
|
 |