Identification |
Name: | Piperonylic acid |
Synonyms: | 3,4-Methylenedioxybenzoic acid; Piperonylic acid, (3,4-Methylenedioxybenzoic acid); 3,4-Methylendioxy-benzoic acid; 1-3-Benzodioxole-5-carboxylic acid~3,4-(Methylenedioxy)benzoic acid |
CAS: | 94-53-1 |
EINECS: | 202-342-8 |
Molecular Formula: | C8H6O4 |
Molecular Weight: | 166.13 |
InChI: | InChI=1/C8H6O4/c9-8(10)5-1-2-6-7(3-5)12-4-11-6/h1-3H,4H2,(H,9,10) |
Molecular Structure: |
 |
Properties |
Transport: | 25kgs |
Flash Point: | 139.6°C |
Boiling Point: | 180 (1 torr) |
Density: | 1.468g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.612 |
Water Solubility: | slightly soluble |
Solubility: | |
Appearance: | White to yellowish crystalline |
HS Code: | 29329970 |
Flash Point: | 139.6°C |
Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
 |