| Identification |
| Name: | Piperonylic acid |
| Synonyms: | 3,4-Methylenedioxybenzoic acid; Piperonylic acid, (3,4-Methylenedioxybenzoic acid); 3,4-Methylendioxy-benzoic acid; 1-3-Benzodioxole-5-carboxylic acid~3,4-(Methylenedioxy)benzoic acid |
| CAS: | 94-53-1 |
| EINECS: | 202-342-8 |
| Molecular Formula: | C8H6O4 |
| Molecular Weight: | 166.13 |
| InChI: | InChI=1/C8H6O4/c9-8(10)5-1-2-6-7(3-5)12-4-11-6/h1-3H,4H2,(H,9,10) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Flash Point: | 139.6°C |
| Boiling Point: | 180 (1 torr) |
| Density: | 1.468g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.612 |
| Water Solubility: | slightly soluble |
| Solubility: | |
| Appearance: | White to yellowish crystalline |
| HS Code: | 29329970 |
| Flash Point: | 139.6°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
