| Identification | |
| Name: | Propanoic acid,2-phenoxy- |
| Synonyms: | Propionicacid, 2-phenoxy- (7CI,8CI);Acide phenoxy-2-propionique;2-PPA;2-Phenoxypropanoic acid;DL-2-Phenoxypropionic acid;NSC 1866;NSC 404102;a-Methylphenoxyacetic acid;a-Phenoxypropionic acid; |
| CAS: | 940-31-8 |
| EINECS: | 213-370-5 |
| Molecular Formula: | C9H10O3 |
| Molecular Weight: | 166.18 |
| InChI: | InChI=1/C9H10O3/c1-7(9(10)11)12-8-5-3-2-4-6-8/h2-7H,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 86 C |
| Density: | 1.174 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Very soluble |
| Appearance: | off white crystalline powder |
| Specification: |
Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances.Wash thoroughly after handling. Remove contaminated clothing and wash before reuse. Use with adequate ventilation. Minimize dust generation and accumulation. Avoid contact with eyes, skin, and clothing. Keep container tightly closed. Avoid ingestion and inhalation. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 86 C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols | |
 |
|
