Identification |
Name: | L-Gulonic acid,5,6-O-(1-methylethylidene)-, g-lactone |
Synonyms: | 5,6-Isopropylidene-L-gulonicacid g-lactone |
CAS: | 94697-68-4 |
Molecular Formula: | C9H14 O6 |
Molecular Weight: | 218.2 |
InChI: | InChI=1/C9H14O6/c1-9(2)13-3-4(15-9)7-5(10)6(11)8(12)14-7/h4-7,10-11H,3H2,1-2H3/t4?,5-,6?,7+/m0/s1 |
Molecular Structure: |
 |
Properties |
Melting Point: | 166-170 °C
|
Refractive index: | 1.536 |
Usage: | A useful starting material for the synthesis of an array of compounds modified in the 2 and 3 positions |
Safety Data |
|
 |