| Identification | |
| Name: | L-Gulonic acid,5,6-O-(1-methylethylidene)-, g-lactone |
| Synonyms: | 5,6-Isopropylidene-L-gulonicacid g-lactone |
| CAS: | 94697-68-4 |
| Molecular Formula: | C9H14 O6 |
| Molecular Weight: | 218.2 |
| InChI: | InChI=1/C9H14O6/c1-9(2)13-3-4(15-9)7-5(10)6(11)8(12)14-7/h4-7,10-11H,3H2,1-2H3/t4?,5-,6?,7+/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 166-170 °C |
| Refractive index: | 1.536 |
| Usage: | A useful starting material for the synthesis of an array of compounds modified in the 2 and 3 positions |
| Safety Data | |
 |
|
