| Identification | |
| Name: | Butanoic acid,2-ethyl-, 1,1'-[1,2-ethanediylbis(oxy-2,1-ethanediyl)] ester |
| Synonyms: | Butanoicacid, 2-ethyl-, 1,2-ethanediylbis(oxy-2,1-ethanediyl) ester (9CI); Butyric acid,2-ethyl-, diester with triethylene glycol (6CI,7CI,8CI); Triethylene glycol,bis(2-ethylbutyrate) (8CI); Flexol 3GH; NSC 406329; Triethylene glycoldi-2-ethylbutylate; Triethylene glycol di-2-ethylbutyrate; Triethylene glycoldiethylbutyrate |
| CAS: | 95-08-9 |
| EINECS: | 202-389-4 |
| Molecular Formula: | C18H34 O6 |
| Molecular Weight: | 346.52 |
| InChI: | InChI=1/C18H34O6/c1-5-15(6-2)17(19)23-13-11-21-9-10-22-12-14-24-18(20)16(7-3)8-4/h15-16H,5-14H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 173.5°C |
| Boiling Point: | 409°C at 760 mmHg |
| Density: | 1.001g/cm3 |
| Refractive index: | 1.446 |
| Solubility: | 0.02% BY WT IN WATER @ 20 DEG C |
| Specification: |
Triethylene glycol bis(2-ethylbutyrate) ,its CAS NO. is 95-08-9,the synonyms is 2,2'-(Ethylenedioxy)di(ethyl 2-ethylbutyrate) ; 2-Ethylbutric acid, triethylene glycol diester ; 2-Ethylbutyric acid, diester with triethylene glycol ; Butanoic acid, 2-ethyl-, 1,2-ethanediylbis(oxy-2,1-ethanediyl) ester ; Butyric acid, 2-ethyl-, diester with triethylene glycol ; Flexol plasticizer 3GH ; Plasticizer 3GH ; Triethyleneglycol diethyl butyrate ; Triglycol di-(2-ethylbutyrate) ; Triglycol dicaproate ; Triglycol dihexoate ; 2,2'-Ethylenedioxydiethyl bis(2-ethylbutyrate) . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 173.5°C |
| Color: | LIGHT-COLORED LIQUID |
| Safety Data | |
 |
|
