| Identification | |
| Name: | 2-Methylindole |
| Synonyms: | Indole, 2-methyl-;2-Methyl-1Hindole;Indole, 2-methyl- (8CI);2-Methyl-1H-indole;1H-indole, 2-methyl-; |
| CAS: | 95-20-5 |
| EINECS: | 202-398-3 |
| Molecular Formula: | C9H9N |
| Molecular Weight: | 131.17 |
| InChI: | InChI=1/C9H9N/c1-7-6-8-4-2-3-5-9(8)10-7/h2-6,10H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 50kgs |
| Density: | 1.07 |
| Stability: | Stable under normal shipping and handling conditions. Substance undergoes color change upon exposure to light and air. |
| Refractive index: | 1.654? |
| Solubility: | Insoluble |
| Appearance: | yellow to reddish-purple or brown crystals, flakes |
| Specification: |
?2-Methylindole ,?its cas register number is 95-20-5. It also can be called?2-Methyl-1H-indole ; AI3-03945 ; NSC 7514 ;?Indole, 2-methyl- (8CI) .?2-Methylindole (CAS NO.95-20-5) is a?yellow to reddish-purple or brown crystals, flakes. |
| HS Code: | 29339990 |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
