| Identification | |
| Name: | 3,4-Dimethylphenol |
| Synonyms: | 3,4-Xylenol; 3; 4-Dimethylphenol; |
| CAS: | 95-65-8 |
| EINECS: | 202-439-5 |
| Molecular Formula: | C8H10O |
| Molecular Weight: | 122.17 |
| InChI: | InChI=1/C8H10O/c1-6-3-4-8(9)5-7(6)2/h3-5,9H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2261 |
| Density: | 1.138 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5442 (20 C) |
| Water Solubility: | SLIGHTLY SOLUBLE |
| Solubility: | SLIGHTLY SOLUBLE |
| Appearance: | white crystal |
| Packinggroup: | II |
| HS Code: | 29071400 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Needles from water Prisms from ligroin |
| Usage: | Starting materials in the phenolic resins. Xylenols. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
