| Identification | |
| Name: | 2,4-Diaminotoluene |
| Synonyms: | 2,4-Toluenediamine; 4-Methyl-1,3-phenylenediamine; 2,4-Toluilenediamine; Toluene-2,4-diamine; 4-Methyl-m-phenylenediamine; C.I.76035; C.I.Oxidation base |
| CAS: | 95-80-7 |
| EINECS: | 202-453-1 |
| Molecular Formula: | C7H10N2 |
| Molecular Weight: | 122.16 |
| InChI: | InChI=1/C7H10N2/c1-5-2-3-6(8)4-7(5)9/h2-4H,8-9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1709 |
| Density: | 283 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Appearance: | Colorless crystal |
| Specification: |
?Toluene-2,4-diamine , its cas register number is 95-80-7. It also can be called?[4,4'-Bi-3H-pyrazole]-3,3'-dione, 2,2',4,4'-tetrahydro-5,5'-dimethyl-2,2'-diphenyl- ; 2,4-Diaminotoluene ; 2,4-TDA ; 3,3'-Dimethyl-1,1'-diphenyl-4,4'-bi-5-pyrazolone ; 4-Methyl-m-phenylenediamine .It is a?brown crystalline powder, crystals or flakes. It?soluble in water, alcohol and ether. |
| Packinggroup: | III |
| HS Code: | 29215119 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | NEEDLES FROM WATER OR CRYSTALS FROM ALCOHOL PRISMS COLORLESS CRYSTALS Colorless to brown, needle shaped crystals or powder [Note: Tends to darken on storage & exposure to air]. |
| Usage: | Photographic developer, industrial interrmediate. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
