Identification |
Name: | Benzoicacid, 2-[(ethoxycarbonyl)oxy]-, methyl ester |
Synonyms: | Carbonicacid, ethyl ester, ester with methyl salicylate(7CI); NSC 406656 |
CAS: | 95390-39-9 |
Molecular Formula: | C11H12 O5 |
Molecular Weight: | 224.21 |
InChI: | InChI=1/C11H12O5/c1-3-15-11(13)16-9-7-5-4-6-8(9)10(12)14-2/h4-7H,3H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 144.1°C |
Boiling Point: | 327.9°Cat760mmHg |
Density: | 1.193g/cm3 |
Refractive index: | 1.505 |
Flash Point: | 144.1°C |
Safety Data |
|
 |