| Identification | |
| Name: | 2,4,6-trimethylbenzophenone |
| Synonyms: | 2-Benzoylmesitylene; Mesityl phenyl ketone; Methanone, phenyl(2,4,6-trimethylphenyl)- |
| CAS: | 954-16-5 |
| EINECS: | 403-150-9 |
| Molecular Formula: | C16H16O |
| Molecular Weight: | 224.3 |
| InChI: | InChI=1/C16H16O/c1-11-9-12(2)15(13(3)10-11)16(17)14-7-5-4-6-8-14/h4-10H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 50kgs |
| Melting Point: | 35 - 36 C |
| Density: | 1.036 g/cm3 |
| Refractive index: | 1.565 |
| Water Solubility: | 2.655(e) |
| Solubility: | Insoluble AUTOIGNITION |
| Appearance: | clear to yellow semi-solid |
| Specification: |
2,4,6-Trimethylbenzophenone ,its cas register number is 954-16-5. It also can be called Mesitylene, 2-benzoyl- ; Ketone, mesityl phenyl ; Methanone, phenyl(2,4,6-trimethylphenyl)- and Benzophenone, 2,4,6-trimethyl- . |
| Safety Data | |
| Hazard Symbols | |
 |
|
