| Identification | |
| Name: | Benzoyl chloride |
| Synonyms: | Benzoyl chloride 99.5+ % for analysis; Benzoil chloride; 4-Chlorocarbonylpolystyrene |
| CAS: | 98-88-4 |
| EINECS: | 202-710-8 |
| Molecular Formula: | C7H5ClO |
| Molecular Weight: | 140.56 |
| InChI: | InChI=1/C7H5ClO/c8-7(9)6-4-2-1-3-5-6/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1736 |
| Density: | 1.2188 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, water, alcohols, strong bases. Reacts violently with DMSO and vigorously with alkalies. |
| Refractive index: | 1.552-1.554 |
| Water Solubility: | reacts |
| Solubility: | decomposes by water and alcohols |
| Appearance: | Colourless liquid |
| Report: |
Related compounds :BENZOIC ACID, benzoic anhydride, Benzaldehyde |
| Packinggroup: | II |
| HS Code: | 29310095 |
| Sensitive: | Moisture Sensitive |
| Color: | Transparent, colorless liquid Slightly brown liquid |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
