Identification |
Name: | Pentanamide,5-chloro-N-[4-(phenylmethoxy)cyclohexyl]-, trans- (9CI) |
Synonyms: | N-(trans-4-Benzyloxycyclohexyl)-5-chlorovaleramide;trans-5-Chloro-N-[4-(phenylmethoxy)cyclohexyl]-pentanamide |
CAS: | 98454-45-6 |
Molecular Formula: | C18H26 Cl N O2 |
Molecular Weight: | 0 |
InChI: | InChI=1/C18H26ClNO2/c19-13-5-4-8-18(21)20-16-9-11-17(12-10-16)22-14-15-6-2-1-3-7-15/h1-3,6-7,16-17H,4-5,8-14H2,(H,20,21)/t16?,17- |
Molecular Structure: |
![(C18H26ClNO2) N-(trans-4-Benzyloxycyclohexyl)-5-chlorovaleramide;trans-5-Chloro-N-[4-(phenylmethoxy)cyclohexyl]-pe...](https://img1.guidechem.com/chem/e/dict/171/98454-45-6.jpg) |
Properties |
Melting Point: | 108-109.50C |
Flash Point: | 255.776°C |
Boiling Point: | 499.313°C at 760 mmHg |
Density: | 1.111g/cm3 |
Refractive index: | 1.534 |
Flash Point: | 255.776°C |
Usage: | Intermediate of OPC-13013, a metabolite of Cilostazol |
Safety Data |
|
![](/images/detail_15.png) |