| Identification | |
| Name: | Valproic acid |
| Synonyms: | 2-Propylpentanoic acid; Dipropylacetic acid |
| CAS: | 99-66-1 |
| EINECS: | 202-777-3 |
| Molecular Formula: | C8H16O2 |
| Molecular Weight: | 144.21 |
| InChI: | InChI=1/C8H16O2/c1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 20 |
| Melting Point: | 120 - 130 C |
| Density: | 0.92 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.424-1.426 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble Very soluble in Organic solvents |
| Appearance: | clear liquid |
| Packinggroup: | III |
| HS Code: | 29159080 |
| Color: | Colorless liquid |
| Usage: | Antiepileptic; increases levels of -aminobutyric acid(GABA) in the brain. Anticonvulsant that also has efficacy as a mood stabilizer in bipolar disorder |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
