| Identification |
| Name: | Benzenamine,4-(1-methylethyl)- |
| Synonyms: | Cumidine(6CI,7CI,8CI); 1-Amino-4-isopropylbenzene; 4-(1-Methylethyl)benzenamine;4-(2-Propyl)aniline; 4-Amino-1-isopropylbenzene; 4-Aminocumene;4-Aminoisopropylbenzene; 4-Isopropylaniline; 4-Isopropylbenzenamine;4-Isopropylphenylamine; NSC 7198; [4-(1-Methylethyl)phenyl]amine; p-Cumidine;p-Isopropylaniline; b-(4-Aminophenyl)propane |
| CAS: | 99-88-7 |
| EINECS: | 202-797-2 |
| Molecular Formula: | C9H13 N |
| Molecular Weight: | 135.21 |
| InChI: | InChI=1/C9H13N/c1-7(2)8-3-5-9(10)6-4-8/h3-7H,10H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.989 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. Light sensitive. |
| Refractive index: | 1.542-1.544 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | light brown clear liquid |
| HS Code: | 29214980 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from light. |
| Sensitive: | Light Sensitive |
| Usage: | Substance is used in the determination of tungsten. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
