Identification |
Name: | 4-Nitrotoluene |
Synonyms: | 1-Methyl-4-nitrobenzene; Melting point standard 4-nitrotoluene; Para-Nitrotoluene |
CAS: | 99-99-0 |
EINECS: | 202-808-0 |
Molecular Formula: | C7H7NO2 |
Molecular Weight: | 137.14 |
InChI: | InChI=1/C7H7NO2/c1-6-2-4-7(5-3-6)8(9)10/h2-5H,1H3 |
Molecular Structure: |
|
Properties |
Transport: | UN 3446 |
Density: | 1.392 |
Stability: | Stability May be shock sensitive. Incompatible with sulfuric acid, strong bases, reducing agents, strong oxidizing agents. |
Refractive index: | 1.5382 |
Solubility: | 0.35 g/L (20 ºC) |
Appearance: | light yellow crystals |
Packinggroup: | II |
HS Code: | 29042000 |
Storage Temperature: | 0-6°C |
Usage: | Synthesis of intermediates & explosives. |
Safety Data |
Hazard Symbols |
T:Toxic
N:Dangerousfortheenvironment
|
|
|