| Identification |
| Name: | {[(4-bromo-3-chlorophenyl)carbamothioyl]sulfanyl}acetic acid |
| Synonyms: | 4-Bromo-3-chlorodithiocarbanilic acid ester with mercaptoacetic acid;4-Bromo-3-chlorodithiocarbanilic acid glycolate;CARBANILIC ACID, 4-BROMO-3-CHLORODITHIO-, GLYCOLATE;S-(3-Chlor-4-brom-phenyl-thiocarbamoyl)-thioglykolsaeure [German];CARBANILIC ACID, 4-BROMO-3-CHLORODITHIO-, ESTER with MERCAPTOACETIC ACID;AC1MHUE5;LS-50879;LS-50881;S-(3-Chlor-4-brom-phenyl-thiocarbamoyl)-thioglykolsaeure;2-[(4-bromo-3-chlorophenyl)carbamothioylsulfanyl]acetic acid;13037-49-5;73622-97-6 |
| CAS: | 13037-49-5;73622-97-6 |
| Molecular Formula: | C9H7BrClNO2S2 |
| Molecular Weight: | 340.6444 |
| InChI: | InChI=1/C9H7BrClNO2S2/c10-6-2-1-5(3-7(6)11)12-9(15)16-4-8(13)14/h1-3H,4H2,(H,12,15)(H,13,14) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 232.6°C |
| Boiling Point: | 460.9°C at 760 mmHg |
| Density: | 1.855g/cm3 |
| Refractive index: | 1.746 |
| Flash Point: | 232.6°C |
| Safety Data |
| |
 |
