| Identification |
| Name: | methyl prop-2-enoate - chloroethene (1:1) |
| Synonyms: | methyl prop-2-enoate- chloroethene(1:1);2-Propenoic acid, methyl ester, polymer with chloroethene;25035-98-7;AC1Q3FVN;Chloroethene, polymer with methyl 2-propenoate;AC1L51HF;chloroethene; methyl prop-2-enoate;AR-1J6140;chloranylethene; methyl prop-2-enoate;chloroethene; 2-propenoic acid methyl ester;A819939;118817-01-9 |
| CAS: | 118817-01-9;25035-98-7 |
| Molecular Formula: | C6H9ClO2 |
| Molecular Weight: | 148.5875 |
| InChI: | InChI=1/C4H6O2.C2H3Cl/c1-3-4(5)6-2;1-2-3/h3H,1H2,2H3;2H,1H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 6.7°C |
| Boiling Point: | 80.2°C at 760 mmHg |
| Flash Point: | 6.7°C |
| Safety Data |
| |
 |
