| Identification |
| Name: | potassium prop-2-enoate - methyl 2-methylprop-2-enoate (1:1) |
| Synonyms: | Methyl methacrylate-potassium acrylate copolymer;2-Propenoic acid, 2-methyl-, methyl ester, polymer with potassium 2-propenoate;2-Propenoic acid, potassium salt, polymer with methyl 2-methyl-2- propenoate;144645-17-0 |
| CAS: | 144645-17-0 |
| Molecular Formula: | C8H11KO4 |
| Molecular Weight: | 210.2688 |
| InChI: | InChI=1/C5H8O2.C3H4O2.K/c1-4(2)5(6)7-3;1-2-3(4)5;/h1H2,2-3H3;2H,1H2,(H,4,5);/q;;+1/p-1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 10°C |
| Boiling Point: | 100.3°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 10°C |
| Safety Data |
| |
 |
