Identification |
Name: | sodium 2-methylprop-2-enoate - ethyl prop-2-enoate (1:1:1) |
Synonyms: | 2-Propenoic acid, ethyl ester, polymer with 2-methyl-2-propenoic acid, sodium salt;Ethyl 2-propenoate, 2-methyl-2-propenoate polymer, sodium salt;2-Propenoic acid, 2-methyl-, polymer with ethyl 2-propenoate, sodium salt;100218-77-7;41487-53-0 |
CAS: | 100218-77-7;41487-53-0 |
Molecular Formula: | C9H13NaO4 |
Molecular Weight: | 208.1869 |
InChI: | InChI=1/C5H8O2.C4H6O2.Na/c1-3-5(6)7-4-2;1-3(2)4(5)6;/h3H,1,4H2,2H3;1H2,2H3,(H,5,6);/q;;+1/p-1 |
Molecular Structure: |
 |
Properties |
Flash Point: | 15.6°C |
Boiling Point: | 99.5°C at 760 mmHg |
Flash Point: | 15.6°C |
Safety Data |
|
 |