| Identification | |
| Name: | sodium prop-2-enoate 2-methylpropyl 2-methylprop-2-enoate (1:1) |
| Synonyms: | Sodium acrylate, isobutyl methacrylate polymer;2-Propenoic acid, 2-methyl-, 2-methylpropyl ester, polymer with sodium 2-propenoate;2-Propenoic acid, 2-methyl-, 2-methylpropyl ester, polymer with sodium 2-propenoate (1:1);129984-35-6;2-Propenoic acid, 2-methyl-, 2-methylpropyl ester, polymer with 2-propenoic acid, sodium salt;67923-96-0 |
| CAS: | 67923-96-0 |
| Molecular Formula: | C11H17NaO4 |
| Molecular Weight: | 236.24 |
| InChI: | InChI=1/C8H14O2.C3H4O2.Na/c1-6(2)5-10-8(9)7(3)4;1-2-3(4)5;/h6H,3,5H2,1-2,4H3;2H,1H2,(H,4,5);/q;;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 44.4°C |
| Boiling Point: | 155°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 44.4°C |
| Safety Data | |
 |
|
