| Identification | |
| Name: | furan-2,5-dione - prop-1-ene (1:1) |
| Synonyms: | furan-2,5-dione- prop-1-ene(1:1);2,5-Furandione, polymer with 1-propene;25722-45-6;Polypropylene, maleic anhydride polymer;AC1Q6ATX;AC1L51TD;furan-2,5-dione; prop-1-ene;AR-1J1011;Polymer of polypropylene and maleic anhydride;I14-48276;2,5-Furandione, reaction products with polypropylene, chlorinated;29496-44-4 |
| CAS: | 25722-45-6;29496-44-4;68609-36-9 |
| Molecular Formula: | C7H8O3 |
| Molecular Weight: | 140.1366 |
| InChI: | InChI=1/C4H2O3.C3H6/c5-3-1-2-4(6)7-3;1-3-2/h1-2H;3H,1H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 103.3°C |
| Boiling Point: | 202°C at 760 mmHg |
| Flash Point: | 103.3°C |
| Safety Data | |
 |
|
