Identification |
Name: | prop-2-enoic acid - prop-1-ene (1:1) |
Synonyms: | 2-Propenoic acid, polymer with 1-propene;25214-24-8;AC1L51NC;prop-1-ene; prop-2-enoic acid;prop-2-enoic acid - prop-1-ene (1:1);27100-31-8 |
CAS: | 25214-24-8;27100-31-8;76974-71-5 |
Molecular Formula: | C6H10O2 |
Molecular Weight: | 114.1424 |
InChI: | InChI=1/C3H4O2.C3H6/c1-2-3(4)5;1-3-2/h2H,1H2,(H,4,5);3H,1H2,2H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 61.6°C |
Boiling Point: | 141°C at 760 mmHg |
Flash Point: | 61.6°C |
Safety Data |
|
 |