| Identification | |
| Name: | prop-2-enoic acid - 1-(ethenyloxy)-2-methylpropane (1:1) |
| Synonyms: | Poly(acrylic acid-isobutyl vinyl ether);prop-2-enoic acid- 1-(ethenyloxy)-2-methylpropane(1:1);1-(Ethenyloxy)-2-methylpropane polymer with 2-propenoic acid;Propane, 1-(ethenyloxy)-2-methyl-, polymer with 2-propenoic acid;31305-83-6;AC1L4JTD;AC1Q5R9U;3,5-difluoro-2-nitrobenzenamine;AR-1L1857;NSC134438;NSC137645;NSC138778;NSC138779;NSC142078;NSC142970;NSC142971;NSC142972;NSC165258;NSC-134438;NSC-137645;NSC-138778;NSC-138779;NSC-142078;NSC-142970;NSC-142971;NSC-142972;NSC-165258;LS-120808;1-ethenoxy-2-methylpropane; prop-2-enoic acid;A18688 |
| CAS: | 31305-83-6 |
| Molecular Formula: | C9H16O3 |
| Molecular Weight: | 172.2215 |
| InChI: | InChI=1/C6H12O.C3H4O2/c1-4-7-5-6(2)3;1-2-3(4)5/h4,6H,1,5H2,2-3H3;2H,1H2,(H,4,5) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | 83°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | °C |
| Safety Data | |
 |
|
